C21H22N6O2 — CID 43864843
5-methyl-11-(2-morpholin-4-ylethyl)-8-phenyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one (PubChem CID 43864843) has the molecular formula C21H22N6O2 and a molecular weight of 390.45 g/mol. Its IUPAC name is 5-methyl-11-(2-morpholin-4-ylethyl)-8-phenyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one.
| Compound Name | 5-methyl-11-(2-morpholin-4-ylethyl)-8-phenyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one |
|---|---|
| PubChem CID | 43864843 |
| Molecular Formula | C21H22N6O2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 5-methyl-11-(2-morpholin-4-ylethyl)-8-phenyl-2,4,6,7,11-pentazatricyclo[7.4.0.03,7]trideca-1,3,5,8,12-pentaen-10-one |
| SMILES | Cc1nc2nc3ccn(CCN4CCOCC4)c(=O)c3c(-c3ccccc3)n2n1 |
| InChI | InChI=1S/C21H22N6O2/c1-15-22-21-23-17-7-8-26(10-9-25-11-13-29-14-12-25)20(28)18(17)19(27(21)24-15)16-5-3-2-4-6-16/h2-8H,9-14H2,1H3 |
| InChIKey | QBCQZQLTKKSZDH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 77.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |