C25H26N4O4 — CID 43865095
2-(2-methoxyphenyl)-8-(3-morpholin-4-ylpropyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione (PubChem CID 43865095) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-8-(3-morpholin-4-ylpropyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione.
| Compound Name | 2-(2-methoxyphenyl)-8-(3-morpholin-4-ylpropyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
|---|---|
| PubChem CID | 43865095 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 2-(2-methoxyphenyl)-8-(3-morpholin-4-ylpropyl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
| SMILES | COc1ccccc1-n1ccc2nc3ccn(CCCN4CCOCC4)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C25H26N4O4/c1-32-23-6-3-2-5-22(23)29-12-8-21-19(25(29)31)17-18-20(26-21)7-11-28(24(18)30)10-4-9-27-13-15-33-16-14-27/h2-3,5-8,11-12,17H,4,9-10,13-16H2,1H3 |
| InChIKey | VAZADVYYOBXBML-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 78.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|