C26H22N4O4 — CID 43865091
8-[2-(3,4-dimethoxyphenyl)ethyl]-2-pyridin-4-ylpyrido[4,3-b][1,6]naphthyridine-1,9-dione (PubChem CID 43865091) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is 8-[2-(3,4-dimethoxyphenyl)ethyl]-2-pyridin-4-ylpyrido[4,3-b][1,6]naphthyridine-1,9-dione.
| Compound Name | 8-[2-(3,4-dimethoxyphenyl)ethyl]-2-pyridin-4-ylpyrido[4,3-b][1,6]naphthyridine-1,9-dione |
|---|---|
| PubChem CID | 43865091 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 8-[2-(3,4-dimethoxyphenyl)ethyl]-2-pyridin-4-ylpyrido[4,3-b][1,6]naphthyridine-1,9-dione |
| SMILES | COc1ccc(CCn2ccc3nc4ccn(-c5ccncc5)c(=O)c4cc3c2=O)cc1OC |
| InChI | InChI=1S/C26H22N4O4/c1-33-23-4-3-17(15-24(23)34-2)7-12-29-13-8-21-19(25(29)31)16-20-22(28-21)9-14-30(26(20)32)18-5-10-27-11-6-18/h3-6,8-11,13-16H,7,12H2,1-2H3 |
| InChIKey | GBBQASUSXOTGER-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|