C22H18F3N3O3 — CID 43865605
3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione (PubChem CID 43865605) has the molecular formula C22H18F3N3O3 and a molecular weight of 429.40 g/mol. Its IUPAC name is 3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione.
| Compound Name | 3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 43865605 |
| Molecular Formula | C22H18F3N3O3 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2CCc3c([nH]c4ccccc34)C2)C(=O)N1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C22H18F3N3O3/c23-22(24,25)31-14-5-3-4-13(10-14)28-20(29)11-19(21(28)30)27-9-8-16-15-6-1-2-7-17(15)26-18(16)12-27/h1-7,10,19,26H,8-9,11-12H2 |
| InChIKey | GYUKWEDKQGCWLF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|