C23H20F3N3O4 — CID 93232871
(3R)-3-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione (PubChem CID 93232871) has the molecular formula C23H20F3N3O4 and a molecular weight of 459.42 g/mol. Its IUPAC name is (3R)-3-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 93232871 |
| Molecular Formula | C23H20F3N3O4 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | (3R)-3-(6-methoxy-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-[3-(trifluoromethoxy)phenyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN([C@@H]1CC(=O)N(c2cccc(OC(F)(F)F)c2)C1=O)C3 |
| InChI | InChI=1S/C23H20F3N3O4/c1-32-14-5-6-18-17(10-14)16-7-8-28(12-19(16)27-18)20-11-21(30)29(22(20)31)13-3-2-4-15(9-13)33-23(24,25)26/h2-6,9-10,20,27H,7-8,11-12H2,1H3/t20-/m1/s1 |
| InChIKey | MDTHAVOXYVEOGQ-HXUWFJFHSA-N |
| XLogP | 3.77 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|