C24H30N4O3S — CID 43866620
4-(2-methylpropyl)-3-[(4-nitrophenyl)methylsulfanyl]-5-[1-(2-propan-2-ylphenoxy)ethyl]-1,2,4-triazole (PubChem CID 43866620) has the molecular formula C24H30N4O3S and a molecular weight of 454.60 g/mol. Its IUPAC name is 4-(2-methylpropyl)-3-[(4-nitrophenyl)methylsulfanyl]-5-[1-(2-propan-2-ylphenoxy)ethyl]-1,2,4-triazole.
| Compound Name | 4-(2-methylpropyl)-3-[(4-nitrophenyl)methylsulfanyl]-5-[1-(2-propan-2-ylphenoxy)ethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 43866620 |
| Molecular Formula | C24H30N4O3S |
| Molecular Weight | 454.60 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 4-(2-methylpropyl)-3-[(4-nitrophenyl)methylsulfanyl]-5-[1-(2-propan-2-ylphenoxy)ethyl]-1,2,4-triazole |
| SMILES | CC(C)Cn1c(SCc2ccc([N+](=O)[O-])cc2)nnc1C(C)Oc1ccccc1C(C)C |
| InChI | InChI=1S/C24H30N4O3S/c1-16(2)14-27-23(18(5)31-22-9-7-6-8-21(22)17(3)4)25-26-24(27)32-15-19-10-12-20(13-11-19)28(29)30/h6-13,16-18H,14-15H2,1-5H3 |
| InChIKey | HZQUDVRQWICHPM-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.60 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|