C23H19ClN4O3S — CID 43884873
3-[1-(2-chlorophenoxy)ethyl]-5-[(4-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazole (PubChem CID 43884873) has the molecular formula C23H19ClN4O3S and a molecular weight of 466.95 g/mol. Its IUPAC name is 3-[1-(2-chlorophenoxy)ethyl]-5-[(4-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazole.
| Compound Name | 3-[1-(2-chlorophenoxy)ethyl]-5-[(4-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 43884873 |
| Molecular Formula | C23H19ClN4O3S |
| Molecular Weight | 466.95 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 3-[1-(2-chlorophenoxy)ethyl]-5-[(4-nitrophenyl)methylsulfanyl]-4-phenyl-1,2,4-triazole |
| SMILES | CC(Oc1ccccc1Cl)c1nnc(SCc2ccc([N+](=O)[O-])cc2)n1-c1ccccc1 |
| InChI | InChI=1S/C23H19ClN4O3S/c1-16(31-21-10-6-5-9-20(21)24)22-25-26-23(27(22)18-7-3-2-4-8-18)32-15-17-11-13-19(14-12-17)28(29)30/h2-14,16H,15H2,1H3 |
| InChIKey | QTIYKKFTKSPIFK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 83.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.95 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|