C24H23F3N2O3S — CID 43870719
3-phenyl-N-(2,3,4-trifluorophenyl)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide (PubChem CID 43870719) has the molecular formula C24H23F3N2O3S and a molecular weight of 476.52 g/mol. Its IUPAC name is 3-phenyl-N-(2,3,4-trifluorophenyl)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide.
| Compound Name | 3-phenyl-N-(2,3,4-trifluorophenyl)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 43870719 |
| Molecular Formula | C24H23F3N2O3S |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 3-phenyl-N-(2,3,4-trifluorophenyl)-2-[(2,4,6-trimethylphenyl)sulfonylamino]propanamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NC(Cc2ccccc2)C(=O)Nc2ccc(F)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C24H23F3N2O3S/c1-14-11-15(2)23(16(3)12-14)33(31,32)29-20(13-17-7-5-4-6-8-17)24(30)28-19-10-9-18(25)21(26)22(19)27/h4-12,20,29H,13H2,1-3H3,(H,28,30) |
| InChIKey | CEQPVHYZDQIJRF-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|