C25H26N2O6S — CID 43870823
N-(3-acetylphenyl)-2-[(3,4-dimethoxyphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 43870823) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[(3,4-dimethoxyphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | N-(3-acetylphenyl)-2-[(3,4-dimethoxyphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 43870823 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | N-(3-acetylphenyl)-2-[(3,4-dimethoxyphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | COc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)Nc2cccc(C(C)=O)c2)cc1OC |
| InChI | InChI=1S/C25H26N2O6S/c1-17(28)19-10-7-11-20(15-19)26-25(29)22(14-18-8-5-4-6-9-18)27-34(30,31)21-12-13-23(32-2)24(16-21)33-3/h4-13,15-16,22,27H,14H2,1-3H3,(H,26,29) |
| InChIKey | NBIXIWWXAIRDML-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |