C27H24BrN3O5S2 — CID 43881610
2-[N-(benzenesulfonyl)-3-bromoanilino]-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]acetamide (PubChem CID 43881610) has the molecular formula C27H24BrN3O5S2 and a molecular weight of 614.54 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 43881610 |
| Molecular Formula | C27H24BrN3O5S2 |
| Molecular Weight | 614.54 g/mol |
| Exact Mass | 613.03 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-[4-[(3-methylphenyl)sulfamoyl]phenyl]acetamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(NC(=O)CN(c3cccc(Br)c3)S(=O)(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C27H24BrN3O5S2/c1-20-7-5-9-23(17-20)30-37(33,34)25-15-13-22(14-16-25)29-27(32)19-31(24-10-6-8-21(28)18-24)38(35,36)26-11-3-2-4-12-26/h2-18,30H,19H2,1H3,(H,29,32) |
| InChIKey | CGQVWZVKYJACNZ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |