C20H16BrIN2O3S — CID 43891612
2-[N-(benzenesulfonyl)-3-bromoanilino]-N-(4-iodophenyl)acetamide (PubChem CID 43891612) has the molecular formula C20H16BrIN2O3S and a molecular weight of 571.23 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 43891612 |
| Molecular Formula | C20H16BrIN2O3S |
| Molecular Weight | 571.23 g/mol |
| Exact Mass | 569.91 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(CN(c1cccc(Br)c1)S(=O)(=O)c1ccccc1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C20H16BrIN2O3S/c21-15-5-4-6-18(13-15)24(28(26,27)19-7-2-1-3-8-19)14-20(25)23-17-11-9-16(22)10-12-17/h1-13H,14H2,(H,23,25) |
| InChIKey | BLNIRDSAPQVGEQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.23 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|