C20H23NO4 — CID 43885235
methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate (PubChem CID 43885235) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate.
| Compound Name | methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate |
|---|---|
| PubChem CID | 43885235 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)C(C)Oc2cc(C)cc(C)c2C)c1 |
| InChI | InChI=1S/C20H23NO4/c1-12-9-13(2)14(3)18(10-12)25-15(4)19(22)21-17-8-6-7-16(11-17)20(23)24-5/h6-11,15H,1-5H3,(H,21,22) |
| InChIKey | WAGZVDGKSDCKKF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |