methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate

C20H23NO4 — CID 43885235

IUPACmethyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)C(C)Oc2cc(C)cc(C)c2C)c1
InChIInChI=1S/C20H23NO4/c1-12-9-13(2)14(3)18(10-12)25-15(4)19(22)21-17-8-6-7-16(11-17)20(23)24-5/h6-11,15H,1-5H3,(H,21,22)
InChIKeyWAGZVDGKSDCKKF-UHFFFAOYSA-N
MW341.41 g/mol
LogP3.80
Rot. Bonds5

About methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate

methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate (PubChem CID 43885235) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate.

Molecular Properties

Compound Namemethyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate
PubChem CID43885235
Molecular FormulaC20H23NO4
Molecular Weight341.41 g/mol
Exact Mass341.16
IUPAC Namemethyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate
SMILESCOC(=O)c1cccc(NC(=O)C(C)Oc2cc(C)cc(C)c2C)c1
InChIInChI=1S/C20H23NO4/c1-12-9-13(2)14(3)18(10-12)25-15(4)19(22)21-17-8-6-7-16(11-17)20(23)24-5/h6-11,15H,1-5H3,(H,21,22)
InChIKeyWAGZVDGKSDCKKF-UHFFFAOYSA-N
XLogP3.80
TPSA64.63 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500341.41
LogP ≤ 53.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate?
The IUPAC name of methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate (CID 43885235) is methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate.
What is the SMILES notation for methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate?
The canonical SMILES for methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate is COC(=O)c1cccc(NC(=O)C(C)Oc2cc(C)cc(C)c2C)c1.
What is the InChIKey of methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate?
The InChIKey is WAGZVDGKSDCKKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23NO4/c1-12-9-13(2)14(3)18(10-12)25-15(4)19(22)21-17-8-6-7-16(11-17)20(23)24-5/h6-11,15H,1-5H3,(H,21,22).
What are the key properties of methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate?
methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate has a molecular weight of 341.41 g/mol, XLogP of 3.80, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-(2,3,5-trimethylphenoxy)propanoylamino]benzoate is sourced from PubChem (CID 43885235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).