C19H23NO3 — CID 92678107
(2S)-N-(3-methoxyphenyl)-2-(2,3,5-trimethylphenoxy)propanamide (PubChem CID 92678107) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is (2S)-N-(3-methoxyphenyl)-2-(2,3,5-trimethylphenoxy)propanamide.
| Compound Name | (2S)-N-(3-methoxyphenyl)-2-(2,3,5-trimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 92678107 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | (2S)-N-(3-methoxyphenyl)-2-(2,3,5-trimethylphenoxy)propanamide |
| SMILES | COc1cccc(NC(=O)[C@H](C)Oc2cc(C)cc(C)c2C)c1 |
| InChI | InChI=1S/C19H23NO3/c1-12-9-13(2)14(3)18(10-12)23-15(4)19(21)20-16-7-6-8-17(11-16)22-5/h6-11,15H,1-5H3,(H,20,21)/t15-/m0/s1 |
| InChIKey | DGEHQROFQXJWCZ-HNNXBMFYSA-N |
| XLogP | 4.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |