C19H30N2O4S — CID 43885410
methyl 4-[3-(2-ethylpiperidin-1-yl)propylsulfamoylmethyl]benzoate (PubChem CID 43885410) has the molecular formula C19H30N2O4S and a molecular weight of 382.53 g/mol. Its IUPAC name is methyl 4-[3-(2-ethylpiperidin-1-yl)propylsulfamoylmethyl]benzoate.
| Compound Name | methyl 4-[3-(2-ethylpiperidin-1-yl)propylsulfamoylmethyl]benzoate |
|---|---|
| PubChem CID | 43885410 |
| Molecular Formula | C19H30N2O4S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | methyl 4-[3-(2-ethylpiperidin-1-yl)propylsulfamoylmethyl]benzoate |
| SMILES | CCC1CCCCN1CCCNS(=O)(=O)Cc1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C19H30N2O4S/c1-3-18-7-4-5-13-21(18)14-6-12-20-26(23,24)15-16-8-10-17(11-9-16)19(22)25-2/h8-11,18,20H,3-7,12-15H2,1-2H3 |
| InChIKey | BDPYAAFNWLNOJI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|