C17H18ClFN2O4S — CID 43890617
N-(3-chloro-4-methylphenyl)-2-[(5-fluoro-2-methoxyphenyl)sulfonylamino]propanamide (PubChem CID 43890617) has the molecular formula C17H18ClFN2O4S and a molecular weight of 400.86 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-[(5-fluoro-2-methoxyphenyl)sulfonylamino]propanamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-[(5-fluoro-2-methoxyphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 43890617 |
| Molecular Formula | C17H18ClFN2O4S |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-[(5-fluoro-2-methoxyphenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(F)cc1S(=O)(=O)NC(C)C(=O)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C17H18ClFN2O4S/c1-10-4-6-13(9-14(10)18)20-17(22)11(2)21-26(23,24)16-8-12(19)5-7-15(16)25-3/h4-9,11,21H,1-3H3,(H,20,22) |
| InChIKey | PIAAMBNJMNDHSH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |