C29H28N2O5S2 — CID 43891751
2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-phenoxyphenyl)acetamide (PubChem CID 43891751) has the molecular formula C29H28N2O5S2 and a molecular weight of 548.69 g/mol. Its IUPAC name is 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-phenoxyphenyl)acetamide.
| Compound Name | 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-phenoxyphenyl)acetamide |
|---|---|
| PubChem CID | 43891751 |
| Molecular Formula | C29H28N2O5S2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.14 |
| IUPAC Name | 2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)-N-(4-phenoxyphenyl)acetamide |
| SMILES | CCOc1ccc(N(CC(=O)Nc2ccc(Oc3ccccc3)cc2)S(=O)(=O)c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C29H28N2O5S2/c1-3-35-24-15-11-23(12-16-24)31(38(33,34)28-19-17-27(37-2)18-20-28)21-29(32)30-22-9-13-26(14-10-22)36-25-7-5-4-6-8-25/h4-20H,3,21H2,1-2H3,(H,30,32) |
| InChIKey | KMFHSAFVGLNEIG-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |