C26H28N2O6S2 — CID 2890741
ethyl 2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]benzoate (PubChem CID 2890741) has the molecular formula C26H28N2O6S2 and a molecular weight of 528.65 g/mol. Its IUPAC name is ethyl 2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2890741 |
| Molecular Formula | C26H28N2O6S2 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | ethyl 2-[[2-(4-ethoxy-N-(4-methylsulfanylphenyl)sulfonylanilino)acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(SC)cc1 |
| InChI | InChI=1S/C26H28N2O6S2/c1-4-33-20-12-10-19(11-13-20)28(36(31,32)22-16-14-21(35-3)15-17-22)18-25(29)27-24-9-7-6-8-23(24)26(30)34-5-2/h6-17H,4-5,18H2,1-3H3,(H,27,29) |
| InChIKey | BMCYAUULTKVNNV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |