C27H31ClN2O3S — CID 43894914
N-(2-benzylbutyl)-2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide (PubChem CID 43894914) has the molecular formula C27H31ClN2O3S and a molecular weight of 499.08 g/mol. Its IUPAC name is N-(2-benzylbutyl)-2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide.
| Compound Name | N-(2-benzylbutyl)-2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
|---|---|
| PubChem CID | 43894914 |
| Molecular Formula | C27H31ClN2O3S |
| Molecular Weight | 499.08 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | N-(2-benzylbutyl)-2-(3-chloro-2-methyl-N-(4-methylphenyl)sulfonylanilino)acetamide |
| SMILES | CCC(CNC(=O)CN(c1cccc(Cl)c1C)S(=O)(=O)c1ccc(C)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H31ClN2O3S/c1-4-22(17-23-9-6-5-7-10-23)18-29-27(31)19-30(26-12-8-11-25(28)21(26)3)34(32,33)24-15-13-20(2)14-16-24/h5-16,22H,4,17-19H2,1-3H3,(H,29,31) |
| InChIKey | WULNDSWIWCGDEY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.08 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |