C22H25N5O5S2 — CID 43908051
N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-2-(N-methylsulfonylanilino)butanamide (PubChem CID 43908051) has the molecular formula C22H25N5O5S2 and a molecular weight of 503.61 g/mol. Its IUPAC name is N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-2-(N-methylsulfonylanilino)butanamide.
| Compound Name | N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-2-(N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 43908051 |
| Molecular Formula | C22H25N5O5S2 |
| Molecular Weight | 503.61 g/mol |
| Exact Mass | 503.13 |
| IUPAC Name | N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-2-(N-methylsulfonylanilino)butanamide |
| SMILES | CCC(C(=O)Nc1ccc(S(=O)(=O)Nc2nccc(C)n2)cc1)N(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C22H25N5O5S2/c1-4-20(27(33(3,29)30)18-8-6-5-7-9-18)21(28)25-17-10-12-19(13-11-17)34(31,32)26-22-23-15-14-16(2)24-22/h5-15,20H,4H2,1-3H3,(H,25,28)(H,23,24,26) |
| InChIKey | AGOCCLCPIJWLCK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.61 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |