C23H26N4O5S2 — CID 99949700
(2R)-2-(4-methyl-N-methylsulfonylanilino)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]butanamide (PubChem CID 99949700) has the molecular formula C23H26N4O5S2 and a molecular weight of 502.62 g/mol. Its IUPAC name is (2R)-2-(4-methyl-N-methylsulfonylanilino)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]butanamide.
| Compound Name | (2R)-2-(4-methyl-N-methylsulfonylanilino)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]butanamide |
|---|---|
| PubChem CID | 99949700 |
| Molecular Formula | C23H26N4O5S2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | (2R)-2-(4-methyl-N-methylsulfonylanilino)-N-[4-(pyridin-2-ylsulfamoyl)phenyl]butanamide |
| SMILES | CC[C@H](C(=O)Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1)N(c1ccc(C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C23H26N4O5S2/c1-4-21(27(33(3,29)30)19-12-8-17(2)9-13-19)23(28)25-18-10-14-20(15-11-18)34(31,32)26-22-7-5-6-16-24-22/h5-16,21H,4H2,1-3H3,(H,24,26)(H,25,28)/t21-/m1/s1 |
| InChIKey | GGOOWSWDWNTCAF-OAQYLSRUSA-N |
| XLogP | 3.37 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |