C24H16ClF6N3O2 — CID 43913477
N-[5-chloro-2-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 43913477) has the molecular formula C24H16ClF6N3O2 and a molecular weight of 527.85 g/mol. Its IUPAC name is N-[5-chloro-2-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[5-chloro-2-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 43913477 |
| Molecular Formula | C24H16ClF6N3O2 |
| Molecular Weight | 527.85 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | N-[5-chloro-2-[4-(2-fluorobenzoyl)piperazin-1-yl]phenyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1N1CCN(C(=O)c2ccccc2F)CC1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H16ClF6N3O2/c25-12-5-6-16(33-7-9-34(10-8-33)24(36)13-3-1-2-4-14(13)26)15(11-12)32-23(35)17-18(27)20(29)22(31)21(30)19(17)28/h1-6,11H,7-10H2,(H,32,35) |
| InChIKey | LLCMHLONOCWATA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.85 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|