C33H35N3O3S — CID 43918944
N,N-dibenzyl-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzamide (PubChem CID 43918944) has the molecular formula C33H35N3O3S and a molecular weight of 553.73 g/mol. Its IUPAC name is N,N-dibenzyl-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzamide.
| Compound Name | N,N-dibenzyl-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 43918944 |
| Molecular Formula | C33H35N3O3S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | N,N-dibenzyl-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(Cc3cccc(C(=O)N(Cc4ccccc4)Cc4ccccc4)c3)CC2)cc1 |
| InChI | InChI=1S/C33H35N3O3S/c1-27-15-17-32(18-16-27)40(38,39)36-21-19-34(20-22-36)24-30-13-8-14-31(23-30)33(37)35(25-28-9-4-2-5-10-28)26-29-11-6-3-7-12-29/h2-18,23H,19-22,24-26H2,1H3 |
| InChIKey | GRDZOQUUUXWPQN-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |