C22H27N3O5S — CID 43922385
[4-(4-methoxyphenyl)piperazin-1-yl]-(5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepin-2-yl)methanone (PubChem CID 43922385) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperazin-1-yl]-(5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepin-2-yl)methanone.
| Compound Name | [4-(4-methoxyphenyl)piperazin-1-yl]-(5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepin-2-yl)methanone |
|---|---|
| PubChem CID | 43922385 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-(5-methylsulfonyl-3,4-dihydro-2H-1,5-benzoxazepin-2-yl)methanone |
| SMILES | COc1ccc(N2CCN(C(=O)C3CCN(S(C)(=O)=O)c4ccccc4O3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O5S/c1-29-18-9-7-17(8-10-18)23-13-15-24(16-14-23)22(26)21-11-12-25(31(2,27)28)19-5-3-4-6-20(19)30-21/h3-10,21H,11-16H2,1-2H3 |
| InChIKey | OENGXHOKMGMNMA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|