C21H24ClN3O5S — CID 93491702
[(2R)-6-chloro-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 93491702) has the molecular formula C21H24ClN3O5S and a molecular weight of 465.96 g/mol. Its IUPAC name is [(2R)-6-chloro-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [(2R)-6-chloro-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 93491702 |
| Molecular Formula | C21H24ClN3O5S |
| Molecular Weight | 465.96 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | [(2R)-6-chloro-4-methylsulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)[C@H]3CN(S(C)(=O)=O)c4cc(Cl)ccc4O3)CC2)cc1 |
| InChI | InChI=1S/C21H24ClN3O5S/c1-29-17-6-4-16(5-7-17)23-9-11-24(12-10-23)21(26)20-14-25(31(2,27)28)18-13-15(22)3-8-19(18)30-20/h3-8,13,20H,9-12,14H2,1-2H3/t20-/m1/s1 |
| InChIKey | IFWYJFZAHIPNSW-HXUWFJFHSA-N |
| XLogP | 2.22 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.96 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|