C25H33N3O2 — CID 43925648
N-[2-(tert-butylcarbamoyl)phenyl]-1-[(2-methylphenyl)methyl]piperidine-3-carboxamide (PubChem CID 43925648) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[2-(tert-butylcarbamoyl)phenyl]-1-[(2-methylphenyl)methyl]piperidine-3-carboxamide.
| Compound Name | N-[2-(tert-butylcarbamoyl)phenyl]-1-[(2-methylphenyl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43925648 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[2-(tert-butylcarbamoyl)phenyl]-1-[(2-methylphenyl)methyl]piperidine-3-carboxamide |
| SMILES | Cc1ccccc1CN1CCCC(C(=O)Nc2ccccc2C(=O)NC(C)(C)C)C1 |
| InChI | InChI=1S/C25H33N3O2/c1-18-10-5-6-11-19(18)16-28-15-9-12-20(17-28)23(29)26-22-14-8-7-13-21(22)24(30)27-25(2,3)4/h5-8,10-11,13-14,20H,9,12,15-17H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | WOGDYMFSNOFJML-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |