C22H25ClN2O3 — CID 93490772
ethyl 2-[[(3R)-1-[(2-chlorophenyl)methyl]piperidine-3-carbonyl]amino]benzoate (PubChem CID 93490772) has the molecular formula C22H25ClN2O3 and a molecular weight of 400.91 g/mol. Its IUPAC name is ethyl 2-[[(3R)-1-[(2-chlorophenyl)methyl]piperidine-3-carbonyl]amino]benzoate.
| Compound Name | ethyl 2-[[(3R)-1-[(2-chlorophenyl)methyl]piperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 93490772 |
| Molecular Formula | C22H25ClN2O3 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | ethyl 2-[[(3R)-1-[(2-chlorophenyl)methyl]piperidine-3-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)[C@@H]1CCCN(Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C22H25ClN2O3/c1-2-28-22(27)18-10-4-6-12-20(18)24-21(26)17-9-7-13-25(15-17)14-16-8-3-5-11-19(16)23/h3-6,8,10-12,17H,2,7,9,13-15H2,1H3,(H,24,26)/t17-/m1/s1 |
| InChIKey | GJCZYTHZJVNTDY-QGZVFWFLSA-N |
| XLogP | 4.37 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |