C23H23ClN2O — CID 93490606
(3R)-1-[(2-chlorophenyl)methyl]-N-naphthalen-1-ylpiperidine-3-carboxamide (PubChem CID 93490606) has the molecular formula C23H23ClN2O and a molecular weight of 378.90 g/mol. Its IUPAC name is (3R)-1-[(2-chlorophenyl)methyl]-N-naphthalen-1-ylpiperidine-3-carboxamide.
| Compound Name | (3R)-1-[(2-chlorophenyl)methyl]-N-naphthalen-1-ylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 93490606 |
| Molecular Formula | C23H23ClN2O |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | (3R)-1-[(2-chlorophenyl)methyl]-N-naphthalen-1-ylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc2ccccc12)[C@@H]1CCCN(Cc2ccccc2Cl)C1 |
| InChI | InChI=1S/C23H23ClN2O/c24-21-12-4-2-8-18(21)15-26-14-6-10-19(16-26)23(27)25-22-13-5-9-17-7-1-3-11-20(17)22/h1-5,7-9,11-13,19H,6,10,14-16H2,(H,25,27)/t19-/m1/s1 |
| InChIKey | PKZOZDHWPBOHCM-LJQANCHMSA-N |
| XLogP | 5.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |