About L-Cystathionine
L-Cystathionine (PubChem CID 439258) has the molecular formula C7H14N2O4S
and a molecular weight of 222.26 g/mol. Its IUPAC name is (2S)-2-amino-4-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid.
Molecular Properties
| Compound Name | L-Cystathionine |
| PubChem CID | 439258 |
| Molecular Formula | C7H14N2O4S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (2S)-2-amino-4-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid |
| SMILES | C(CSC[C@@H](C(=O)O)N)[C@@H](C(=O)O)N |
| InChI | InChI=1S/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1 |
| InChIKey | ILRYLPWNYFXEMH-WHFBIAKZSA-N |
| XLogP | -6.00 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | 212 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | -6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze L-Cystathionine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of L-Cystathionine?
The IUPAC name of L-Cystathionine (CID 439258) is (2S)-2-amino-4-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid.
What is the SMILES notation for L-Cystathionine?
The canonical SMILES for L-Cystathionine is C(CSC[C@@H](C(=O)O)N)[C@@H](C(=O)O)N.
What is the InChIKey of L-Cystathionine?
The InChIKey is ILRYLPWNYFXEMH-WHFBIAKZSA-N. The full InChI is InChI=1S/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1.
What are the key properties of L-Cystathionine?
L-Cystathionine has a molecular weight of 222.26 g/mol, XLogP of -6.00, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for L-Cystathionine is sourced from PubChem (CID 439258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).