About L-Homocysteine
L-Homocysteine (PubChem CID 91552) has the molecular formula C4H9NO2S
and a molecular weight of 135.19 g/mol. Its IUPAC name is (2S)-2-amino-4-sulfanylbutanoic acid.
Molecular Properties
| Compound Name | L-Homocysteine |
| PubChem CID | 91552 |
| Molecular Formula | C4H9NO2S |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.04 |
| IUPAC Name | (2S)-2-amino-4-sulfanylbutanoic acid |
| SMILES | C(CS)[C@@H](C(=O)O)N |
| InChI | InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m0/s1 |
| InChIKey | FFFHZYDWPBMWHY-VKHMYHEASA-N |
| XLogP | -3.40 |
| TPSA | 64.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | 86 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | -3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze L-Homocysteine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of L-Homocysteine?
The IUPAC name of L-Homocysteine (CID 91552) is (2S)-2-amino-4-sulfanylbutanoic acid.
What is the SMILES notation for L-Homocysteine?
The canonical SMILES for L-Homocysteine is C(CS)[C@@H](C(=O)O)N.
What is the InChIKey of L-Homocysteine?
The InChIKey is FFFHZYDWPBMWHY-VKHMYHEASA-N. The full InChI is InChI=1S/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m0/s1.
What are the key properties of L-Homocysteine?
L-Homocysteine has a molecular weight of 135.19 g/mol, XLogP of -3.40, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for L-Homocysteine is sourced from PubChem (CID 91552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).