About DL-cysteine
DL-cysteine (PubChem CID 594) has the molecular formula C3H7NO2S
and a molecular weight of 121.16 g/mol. Its IUPAC name is 2-amino-3-sulfanylpropanoic acid.
Molecular Properties
| Compound Name | DL-cysteine |
| PubChem CID | 594 |
| Molecular Formula | C3H7NO2S |
| Molecular Weight | 121.16 g/mol |
| Exact Mass | 121.02 |
| IUPAC Name | 2-amino-3-sulfanylpropanoic acid |
| SMILES | C(C(C(=O)O)N)S |
| InChI | InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6) |
| InChIKey | XUJNEKJLAYXESH-UHFFFAOYSA-N |
| XLogP | -2.50 |
| TPSA | 64.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | 75 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.16 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze DL-cysteine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of DL-cysteine?
The IUPAC name of DL-cysteine (CID 594) is 2-amino-3-sulfanylpropanoic acid.
What is the SMILES notation for DL-cysteine?
The canonical SMILES for DL-cysteine is C(C(C(=O)O)N)S.
What is the InChIKey of DL-cysteine?
The InChIKey is XUJNEKJLAYXESH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6).
What are the key properties of DL-cysteine?
DL-cysteine has a molecular weight of 121.16 g/mol, XLogP of -2.50, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for DL-cysteine is sourced from PubChem (CID 594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).