(2R)-2-amino-3-sulfanylpropanoic acid

C3H7NO2S — CID 5862

IUPAC(2R)-2-amino-3-sulfanylpropanoic acid
SMILESN[C@@H](CS)C(=O)O
InChIInChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1
InChIKeyXUJNEKJLAYXESH-REOHCLBHSA-N
MW121.16 g/mol
LogP-0.67
Rot. Bonds2

About (2R)-2-amino-3-sulfanylpropanoic acid

(2R)-2-amino-3-sulfanylpropanoic acid (PubChem CID 5862) has the molecular formula C3H7NO2S and a molecular weight of 121.16 g/mol. Its IUPAC name is (2R)-2-amino-3-sulfanylpropanoic acid.

Molecular Properties

Compound Name(2R)-2-amino-3-sulfanylpropanoic acid
PubChem CID5862
Molecular FormulaC3H7NO2S
Molecular Weight121.16 g/mol
Exact Mass121.02
IUPAC Name(2R)-2-amino-3-sulfanylpropanoic acid
SMILESN[C@@H](CS)C(=O)O
InChIInChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1
InChIKeyXUJNEKJLAYXESH-REOHCLBHSA-N
XLogP-0.67
TPSA63.32 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500121.16
LogP ≤ 5-0.67
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze (2R)-2-amino-3-sulfanylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-3-sulfanylpropanoic acid?
The IUPAC name of (2R)-2-amino-3-sulfanylpropanoic acid (CID 5862) is (2R)-2-amino-3-sulfanylpropanoic acid.
What is the SMILES notation for (2R)-2-amino-3-sulfanylpropanoic acid?
The canonical SMILES for (2R)-2-amino-3-sulfanylpropanoic acid is N[C@@H](CS)C(=O)O.
What is the InChIKey of (2R)-2-amino-3-sulfanylpropanoic acid?
The InChIKey is XUJNEKJLAYXESH-REOHCLBHSA-N. The full InChI is InChI=1S/C3H7NO2S/c4-2(1-7)3(5)6/h2,7H,1,4H2,(H,5,6)/t2-/m0/s1.
What are the key properties of (2R)-2-amino-3-sulfanylpropanoic acid?
(2R)-2-amino-3-sulfanylpropanoic acid has a molecular weight of 121.16 g/mol, XLogP of -0.67, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-3-sulfanylpropanoic acid is sourced from PubChem (CID 5862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).