C27H32N4O4 — CID 43927735
1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperidine-4-carboxamide (PubChem CID 43927735) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperidine-4-carboxamide.
| Compound Name | 1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 43927735 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 1-[[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)piperidine-4-carboxamide |
| SMILES | COc1ccc(-c2noc(CN3CCC(C(=O)NC4CCCc5ccccc54)CC3)n2)cc1OC |
| InChI | InChI=1S/C27H32N4O4/c1-33-23-11-10-20(16-24(23)34-2)26-29-25(35-30-26)17-31-14-12-19(13-15-31)27(32)28-22-9-5-7-18-6-3-4-8-21(18)22/h3-4,6,8,10-11,16,19,22H,5,7,9,12-15,17H2,1-2H3,(H,28,32) |
| InChIKey | VGVQRXQVNVBLKQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |