C26H30N4O4 — CID 43929232
butyl 4-[[1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carbonyl]amino]benzoate (PubChem CID 43929232) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is butyl 4-[[1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 43929232 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | butyl 4-[[1-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidine-3-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2CCCN(Cc3nc(-c4ccccc4)no3)C2)cc1 |
| InChI | InChI=1S/C26H30N4O4/c1-2-3-16-33-26(32)20-11-13-22(14-12-20)27-25(31)21-10-7-15-30(17-21)18-23-28-24(29-34-23)19-8-5-4-6-9-19/h4-6,8-9,11-14,21H,2-3,7,10,15-18H2,1H3,(H,27,31) |
| InChIKey | RBLMRZQLFCGTEV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|