C26H29ClN4O4 — CID 43934263
butyl 4-[[1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carbonyl]amino]benzoate (PubChem CID 43934263) has the molecular formula C26H29ClN4O4 and a molecular weight of 497.00 g/mol. Its IUPAC name is butyl 4-[[1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 43934263 |
| Molecular Formula | C26H29ClN4O4 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | butyl 4-[[1-[[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2CCCN(Cc3nc(-c4cccc(Cl)c4)no3)C2)cc1 |
| InChI | InChI=1S/C26H29ClN4O4/c1-2-3-14-34-26(33)18-9-11-22(12-10-18)28-25(32)20-7-5-13-31(16-20)17-23-29-24(30-35-23)19-6-4-8-21(27)15-19/h4,6,8-12,15,20H,2-3,5,7,13-14,16-17H2,1H3,(H,28,32) |
| InChIKey | BDWCYOZMJDLDEW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|