C24H34N4O3 — CID 43930217
N-(3-cyclopentyloxypropyl)-1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide (PubChem CID 43930217) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-(3-cyclopentyloxypropyl)-1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide.
| Compound Name | N-(3-cyclopentyloxypropyl)-1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43930217 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | N-(3-cyclopentyloxypropyl)-1-[[3-(3-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide |
| SMILES | Cc1cccc(-c2noc(CN3CCCC(C(=O)NCCCOC4CCCC4)C3)n2)c1 |
| InChI | InChI=1S/C24H34N4O3/c1-18-7-4-8-19(15-18)23-26-22(31-27-23)17-28-13-5-9-20(16-28)24(29)25-12-6-14-30-21-10-2-3-11-21/h4,7-8,15,20-21H,2-3,5-6,9-14,16-17H2,1H3,(H,25,29) |
| InChIKey | AIWBXDKEMTUGMM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|