C28H42N4O3 — CID 43932281
1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclohexyloxypropyl)piperidine-3-carboxamide (PubChem CID 43932281) has the molecular formula C28H42N4O3 and a molecular weight of 482.67 g/mol. Its IUPAC name is 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclohexyloxypropyl)piperidine-3-carboxamide.
| Compound Name | 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclohexyloxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43932281 |
| Molecular Formula | C28H42N4O3 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | 1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-(3-cyclohexyloxypropyl)piperidine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(-c2noc(CN3CCCC(C(=O)NCCCOC4CCCCC4)C3)n2)cc1 |
| InChI | InChI=1S/C28H42N4O3/c1-28(2,3)23-14-12-21(13-15-23)26-30-25(35-31-26)20-32-17-7-9-22(19-32)27(33)29-16-8-18-34-24-10-5-4-6-11-24/h12-15,22,24H,4-11,16-20H2,1-3H3,(H,29,33) |
| InChIKey | WZWMKUNYHYRMPH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|