C29H38N4O2S — CID 43932272
N-(3-benzylsulfanylpropyl)-1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide (PubChem CID 43932272) has the molecular formula C29H38N4O2S and a molecular weight of 506.72 g/mol. Its IUPAC name is N-(3-benzylsulfanylpropyl)-1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide.
| Compound Name | N-(3-benzylsulfanylpropyl)-1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43932272 |
| Molecular Formula | C29H38N4O2S |
| Molecular Weight | 506.72 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | N-(3-benzylsulfanylpropyl)-1-[[3-(4-tert-butylphenyl)-1,2,4-oxadiazol-5-yl]methyl]piperidine-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(-c2noc(CN3CCCC(C(=O)NCCCSCc4ccccc4)C3)n2)cc1 |
| InChI | InChI=1S/C29H38N4O2S/c1-29(2,3)25-14-12-23(13-15-25)27-31-26(35-32-27)20-33-17-7-11-24(19-33)28(34)30-16-8-18-36-21-22-9-5-4-6-10-22/h4-6,9-10,12-15,24H,7-8,11,16-21H2,1-3H3,(H,30,34) |
| InChIKey | MERDUBWHXZOYRB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.72 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|