C17H15N3O3S — CID 43936677
N-(furan-2-yl)-2-[6-(3-methoxyphenyl)pyridazin-3-yl]sulfanylacetamide (PubChem CID 43936677) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-(furan-2-yl)-2-[6-(3-methoxyphenyl)pyridazin-3-yl]sulfanylacetamide.
| Compound Name | N-(furan-2-yl)-2-[6-(3-methoxyphenyl)pyridazin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 43936677 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-(furan-2-yl)-2-[6-(3-methoxyphenyl)pyridazin-3-yl]sulfanylacetamide |
| SMILES | COc1cccc(-c2ccc(SCC(=O)Nc3ccco3)nn2)c1 |
| InChI | InChI=1S/C17H15N3O3S/c1-22-13-5-2-4-12(10-13)14-7-8-17(20-19-14)24-11-15(21)18-16-6-3-9-23-16/h2-10H,11H2,1H3,(H,18,21) |
| InChIKey | HRVVLVNTNREZJU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |