C19H16FN3O2S — CID 7502862
N-(2-fluorophenyl)-2-[6-(3-methoxyphenyl)pyridazin-3-yl]sulfanylacetamide (PubChem CID 7502862) has the molecular formula C19H16FN3O2S and a molecular weight of 369.42 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[6-(3-methoxyphenyl)pyridazin-3-yl]sulfanylacetamide.
| Compound Name | N-(2-fluorophenyl)-2-[6-(3-methoxyphenyl)pyridazin-3-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 7502862 |
| Molecular Formula | C19H16FN3O2S |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | N-(2-fluorophenyl)-2-[6-(3-methoxyphenyl)pyridazin-3-yl]sulfanylacetamide |
| SMILES | COc1cccc(-c2ccc(SCC(=O)Nc3ccccc3F)nn2)c1 |
| InChI | InChI=1S/C19H16FN3O2S/c1-25-14-6-4-5-13(11-14)16-9-10-19(23-22-16)26-12-18(24)21-17-8-3-2-7-15(17)20/h2-11H,12H2,1H3,(H,21,24) |
| InChIKey | OOUKLVMYLOQZKV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |