C18H17NO4 — CID 43949881
6-[2-(2-hydroxyethoxy)ethyl]benzo[d][2]benzazepine-5,7-dione (PubChem CID 43949881) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 6-[2-(2-hydroxyethoxy)ethyl]benzo[d][2]benzazepine-5,7-dione.
| Compound Name | 6-[2-(2-hydroxyethoxy)ethyl]benzo[d][2]benzazepine-5,7-dione |
|---|---|
| PubChem CID | 43949881 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 6-[2-(2-hydroxyethoxy)ethyl]benzo[d][2]benzazepine-5,7-dione |
| SMILES | O=c1c2ccccc2c2ccccc2c(=O)n1CCOCCO |
| InChI | InChI=1S/C18H17NO4/c20-10-12-23-11-9-19-17(21)15-7-3-1-5-13(15)14-6-2-4-8-16(14)18(19)22/h1-8,20H,9-12H2 |
| InChIKey | UZVMNDPWMIWNPI-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|