C46H50N6O16 — CID 139123790
bis(2,6-bis[2-(2-hydroxyethoxy)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone);naphthalene-1,5-diamine (PubChem CID 139123790) has the molecular formula C46H50N6O16 and a molecular weight of 942.93 g/mol. Its IUPAC name is bis(2,6-bis[2-(2-hydroxyethoxy)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone);naphthalene-1,5-diamine.
| Compound Name | bis(2,6-bis[2-(2-hydroxyethoxy)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone);naphthalene-1,5-diamine |
|---|---|
| PubChem CID | 139123790 |
| Molecular Formula | C46H50N6O16 |
| Molecular Weight | 942.93 g/mol |
| Exact Mass | 942.33 |
| IUPAC Name | bis(2,6-bis[2-(2-hydroxyethoxy)ethyl]pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone);naphthalene-1,5-diamine |
| SMILES | Nc1cccc2c(N)cccc12.O=c1c2cc3c(=O)n(CCOCCO)c(=O)c3cc2c(=O)n1CCOCCO.O=c1c2cc3c(=O)n(CCOCCO)c(=O)c3cc2c(=O)n1CCOCCO |
| InChI | InChI=1S/2C18H20N2O8.C10H10N2/c2*21-3-7-27-5-1-19-15(23)11-9-13-14(10-12(11)16(19)24)18(26)20(17(13)25)2-6-28-8-4-22;11-9-5-1-3-7-8(9)4-2-6-10(7)12/h2*9-10,21-22H,1-8H2;1-6H,11-12H2 |
| InChIKey | NYJOKIDBDHUMQQ-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 326.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.93 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|