C24H23ClN2O3S — CID 43949921
4-(4-butoxybenzoyl)-7-chloro-5-thiophen-2-yl-3,5-dihydro-1H-1,4-benzodiazepin-2-one (PubChem CID 43949921) has the molecular formula C24H23ClN2O3S and a molecular weight of 454.98 g/mol. Its IUPAC name is 4-(4-butoxybenzoyl)-7-chloro-5-thiophen-2-yl-3,5-dihydro-1H-1,4-benzodiazepin-2-one.
| Compound Name | 4-(4-butoxybenzoyl)-7-chloro-5-thiophen-2-yl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 43949921 |
| Molecular Formula | C24H23ClN2O3S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | 4-(4-butoxybenzoyl)-7-chloro-5-thiophen-2-yl-3,5-dihydro-1H-1,4-benzodiazepin-2-one |
| SMILES | CCCCOc1ccc(C(=O)N2CC(=O)Nc3ccc(Cl)cc3C2c2cccs2)cc1 |
| InChI | InChI=1S/C24H23ClN2O3S/c1-2-3-12-30-18-9-6-16(7-10-18)24(29)27-15-22(28)26-20-11-8-17(25)14-19(20)23(27)21-5-4-13-31-21/h4-11,13-14,23H,2-3,12,15H2,1H3,(H,26,28) |
| InChIKey | CWQXCWDXPSCVJW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|