C22H26FN7O2 — CID 43957575
2-fluoro-N-[2-[6-[3-(2-oxopiperidin-1-yl)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide (PubChem CID 43957575) has the molecular formula C22H26FN7O2 and a molecular weight of 439.50 g/mol. Its IUPAC name is 2-fluoro-N-[2-[6-[3-(2-oxopiperidin-1-yl)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[6-[3-(2-oxopiperidin-1-yl)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 43957575 |
| Molecular Formula | C22H26FN7O2 |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 2-fluoro-N-[2-[6-[3-(2-oxopiperidin-1-yl)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]benzamide |
| SMILES | O=C(NCCc1nnc2ccc(NCCCN3CCCCC3=O)nn12)c1ccccc1F |
| InChI | InChI=1S/C22H26FN7O2/c23-17-7-2-1-6-16(17)22(32)25-13-11-20-27-26-19-10-9-18(28-30(19)20)24-12-5-15-29-14-4-3-8-21(29)31/h1-2,6-7,9-10H,3-5,8,11-15H2,(H,24,28)(H,25,32) |
| InChIKey | BGWYQDBHHLWOSZ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|