C19H24FN7O — CID 43957703
N-[2-[6-[3-(dimethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-4-fluorobenzamide (PubChem CID 43957703) has the molecular formula C19H24FN7O and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[2-[6-[3-(dimethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-4-fluorobenzamide.
| Compound Name | N-[2-[6-[3-(dimethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 43957703 |
| Molecular Formula | C19H24FN7O |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[2-[6-[3-(dimethylamino)propylamino]-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]ethyl]-4-fluorobenzamide |
| SMILES | CN(C)CCCNc1ccc2nnc(CCNC(=O)c3ccc(F)cc3)n2n1 |
| InChI | InChI=1S/C19H24FN7O/c1-26(2)13-3-11-21-16-8-9-17-23-24-18(27(17)25-16)10-12-22-19(28)14-4-6-15(20)7-5-14/h4-9H,3,10-13H2,1-2H3,(H,21,25)(H,22,28) |
| InChIKey | IHOYXXIGLIHQAH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|