C24H27ClN4O3S2 — CID 43958602
4-[bis(prop-2-enyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 43958602) has the molecular formula C24H27ClN4O3S2 and a molecular weight of 519.09 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 43958602 |
| Molecular Formula | C24H27ClN4O3S2 |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(6-chloro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)N(CCN(C)C)c2nc3ccc(Cl)cc3s2)cc1 |
| InChI | InChI=1S/C24H27ClN4O3S2/c1-5-13-28(14-6-2)34(31,32)20-10-7-18(8-11-20)23(30)29(16-15-27(3)4)24-26-21-12-9-19(25)17-22(21)33-24/h5-12,17H,1-2,13-16H2,3-4H3 |
| InChIKey | WTXNXVWXKWBXSY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|