C24H26F2N4O3S2 — CID 43959192
4-[bis(prop-2-enyl)sulfamoyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 43959192) has the molecular formula C24H26F2N4O3S2 and a molecular weight of 520.63 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 43959192 |
| Molecular Formula | C24H26F2N4O3S2 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-(4,6-difluoro-1,3-benzothiazol-2-yl)-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)N(CCN(C)C)c2nc3c(F)cc(F)cc3s2)cc1 |
| InChI | InChI=1S/C24H26F2N4O3S2/c1-5-11-29(12-6-2)35(32,33)19-9-7-17(8-10-19)23(31)30(14-13-28(3)4)24-27-22-20(26)15-18(25)16-21(22)34-24/h5-10,15-16H,1-2,11-14H2,3-4H3 |
| InChIKey | YXPALOQRDYCFOJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|