C21H31N3O2 — CID 43969516
1-cyclohexyl-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-1-ethylurea (PubChem CID 43969516) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-1-ethylurea.
| Compound Name | 1-cyclohexyl-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-1-ethylurea |
|---|---|
| PubChem CID | 43969516 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 1-cyclohexyl-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-1-ethylurea |
| SMILES | CCN(C(=O)NC1CC(=O)N(c2ccc(C)c(C)c2)C1)C1CCCCC1 |
| InChI | InChI=1S/C21H31N3O2/c1-4-23(18-8-6-5-7-9-18)21(26)22-17-13-20(25)24(14-17)19-11-10-15(2)16(3)12-19/h10-12,17-18H,4-9,13-14H2,1-3H3,(H,22,26) |
| InChIKey | LMKFMOADNPIBLY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |