C23H29N3O2 — CID 43969590
1-butyl-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-1-phenylurea (PubChem CID 43969590) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-butyl-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-1-phenylurea.
| Compound Name | 1-butyl-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-1-phenylurea |
|---|---|
| PubChem CID | 43969590 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 1-butyl-3-[1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]-1-phenylurea |
| SMILES | CCCCN(C(=O)NC1CC(=O)N(c2ccc(C)c(C)c2)C1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O2/c1-4-5-13-25(20-9-7-6-8-10-20)23(28)24-19-15-22(27)26(16-19)21-12-11-17(2)18(3)14-21/h6-12,14,19H,4-5,13,15-16H2,1-3H3,(H,24,28) |
| InChIKey | DCMPZGAAFHEVNY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |