C23H29N3O4 — CID 7552484
1-butyl-3-[(3S)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-1-phenylurea (PubChem CID 7552484) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is 1-butyl-3-[(3S)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-1-phenylurea.
| Compound Name | 1-butyl-3-[(3S)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-1-phenylurea |
|---|---|
| PubChem CID | 7552484 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 1-butyl-3-[(3S)-1-(3,4-dimethoxyphenyl)-5-oxopyrrolidin-3-yl]-1-phenylurea |
| SMILES | CCCCN(C(=O)N[C@H]1CC(=O)N(c2ccc(OC)c(OC)c2)C1)c1ccccc1 |
| InChI | InChI=1S/C23H29N3O4/c1-4-5-13-25(18-9-7-6-8-10-18)23(28)24-17-14-22(27)26(16-17)19-11-12-20(29-2)21(15-19)30-3/h6-12,15,17H,4-5,13-14,16H2,1-3H3,(H,24,28)/t17-/m0/s1 |
| InChIKey | DQNYPEVAFHYNOX-KRWDZBQOSA-N |
| XLogP | 3.83 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |