C23H27FN2O5 — CID 43971125
3,4,5-triethoxy-N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]benzamide (PubChem CID 43971125) has the molecular formula C23H27FN2O5 and a molecular weight of 430.48 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 43971125 |
| Molecular Formula | C23H27FN2O5 |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 3,4,5-triethoxy-N-[1-(3-fluorophenyl)-5-oxopyrrolidin-3-yl]benzamide |
| SMILES | CCOc1cc(C(=O)NC2CC(=O)N(c3cccc(F)c3)C2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H27FN2O5/c1-4-29-19-10-15(11-20(30-5-2)22(19)31-6-3)23(28)25-17-13-21(27)26(14-17)18-9-7-8-16(24)12-18/h7-12,17H,4-6,13-14H2,1-3H3,(H,25,28) |
| InChIKey | MSKDTCOKCKSBOW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |